C24H22N10O3S — CID 165363256
4-[[2,4-diamino-5-[[3-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 165363256) has the molecular formula C24H22N10O3S and a molecular weight of 530.57 g/mol. Its IUPAC name is 4-[[2,4-diamino-5-[[3-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[2,4-diamino-5-[[3-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 165363256 |
| Molecular Formula | C24H22N10O3S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 4-[[2,4-diamino-5-[[3-[(2,4-diaminophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(/N=N/c2cccc(/N=N/c3cc(/N=N/c4ccc(S(=O)(=O)O)cc4)c(N)cc3N)c2)c(N)c1 |
| InChI | InChI=1S/C24H22N10O3S/c25-14-4-9-22(19(26)10-14)32-30-16-2-1-3-17(11-16)31-34-24-13-23(20(27)12-21(24)28)33-29-15-5-7-18(8-6-15)38(35,36)37/h1-13H,25-28H2,(H,35,36,37)/b32-30+,33-29+,34-31+ |
| InChIKey | SDSNMMFEJMABGH-SOGQZCQWSA-N |
| XLogP | 6.51 |
| TPSA | 232.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|