About (4-azidophenyl)arsonic acid
(4-azidophenyl)arsonic acid (PubChem CID 3246304) has the molecular formula C6H6AsN3O3
and a molecular weight of 243.05 g/mol. Its IUPAC name is (4-azidophenyl)arsonic acid.
Molecular Properties
| Compound Name | (4-azidophenyl)arsonic acid |
| PubChem CID | 3246304 |
| Molecular Formula | C6H6AsN3O3 |
| Molecular Weight | 243.05 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | (4-azidophenyl)arsonic acid |
| SMILES | [N-]=[N+]=Nc1ccc([As](=O)(O)O)cc1 |
| InChI | InChI=1S/C6H6AsN3O3/c8-10-9-6-3-1-5(2-4-6)7(11,12)13/h1-4H,(H2,11,12,13) |
| InChIKey | ABBAHMOUCAIMOQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.05 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (4-azidophenyl)arsonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-azidophenyl)arsonic acid?
The IUPAC name of (4-azidophenyl)arsonic acid (CID 3246304) is (4-azidophenyl)arsonic acid.
What is the SMILES notation for (4-azidophenyl)arsonic acid?
The canonical SMILES for (4-azidophenyl)arsonic acid is [N-]=[N+]=Nc1ccc([As](=O)(O)O)cc1.
What is the InChIKey of (4-azidophenyl)arsonic acid?
The InChIKey is ABBAHMOUCAIMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6AsN3O3/c8-10-9-6-3-1-5(2-4-6)7(11,12)13/h1-4H,(H2,11,12,13).
What are the key properties of (4-azidophenyl)arsonic acid?
(4-azidophenyl)arsonic acid has a molecular weight of 243.05 g/mol, XLogP of 0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-azidophenyl)arsonic acid is sourced from PubChem (CID 3246304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).