About bis(1-(4-aminophenyl)ethanone);yttrium
bis(1-(4-aminophenyl)ethanone);yttrium (PubChem CID 58212341) has the molecular formula C16H16N2O2Y-2
and a molecular weight of 357.22 g/mol. Its IUPAC name is bis(1-(4-aminophenyl)ethanone);yttrium.
Molecular Properties
| Compound Name | bis(1-(4-aminophenyl)ethanone);yttrium |
| PubChem CID | 58212341 |
| Molecular Formula | C16H16N2O2Y-2 |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | bis(1-(4-aminophenyl)ethanone);yttrium |
| SMILES | [CH2-]C(=O)c1ccc(N)cc1.[CH2-]C(=O)c1ccc(N)cc1.[Y] |
| InChI | InChI=1S/2C8H8NO.Y/c2*1-6(10)7-2-4-8(9)5-3-7;/h2*2-5H,1,9H2;/q2*-1; |
| InChIKey | FHAVBPYJSJFRMK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(1-(4-aminophenyl)ethanone);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-(4-aminophenyl)ethanone);yttrium?
The IUPAC name of bis(1-(4-aminophenyl)ethanone);yttrium (CID 58212341) is bis(1-(4-aminophenyl)ethanone);yttrium.
What is the SMILES notation for bis(1-(4-aminophenyl)ethanone);yttrium?
The canonical SMILES for bis(1-(4-aminophenyl)ethanone);yttrium is [CH2-]C(=O)c1ccc(N)cc1.[CH2-]C(=O)c1ccc(N)cc1.[Y].
What is the InChIKey of bis(1-(4-aminophenyl)ethanone);yttrium?
The InChIKey is FHAVBPYJSJFRMK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H8NO.Y/c2*1-6(10)7-2-4-8(9)5-3-7;/h2*2-5H,1,9H2;/q2*-1;.
What are the key properties of bis(1-(4-aminophenyl)ethanone);yttrium?
bis(1-(4-aminophenyl)ethanone);yttrium has a molecular weight of 357.22 g/mol, XLogP of 2.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-(4-aminophenyl)ethanone);yttrium is sourced from PubChem (CID 58212341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).