C14H12O — CID 142196065
5-phenylcyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 142196065) has the molecular formula C14H12O and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-phenylcyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | 5-phenylcyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 142196065 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 5-phenylcyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | O=CC1=CC=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C14H12O/c15-11-12-5-4-8-14(10-9-12)13-6-2-1-3-7-13/h1-11,14H |
| InChIKey | IMQMQBSJQDKKAW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|