C12H14O3S — CID 11898208
(2S,3R,5R)-3-hydroxy-3-methyl-5-phenylthiolane-2-carboxylic acid (PubChem CID 11898208) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is (2S,3R,5R)-3-hydroxy-3-methyl-5-phenylthiolane-2-carboxylic acid.
| Compound Name | (2S,3R,5R)-3-hydroxy-3-methyl-5-phenylthiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 11898208 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (2S,3R,5R)-3-hydroxy-3-methyl-5-phenylthiolane-2-carboxylic acid |
| SMILES | C[C@@]1(O)C[C@H](c2ccccc2)S[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H14O3S/c1-12(15)7-9(16-10(12)11(13)14)8-5-3-2-4-6-8/h2-6,9-10,15H,7H2,1H3,(H,13,14)/t9-,10-,12-/m1/s1 |
| InChIKey | YMQZLPSBXBXWNW-CKYFFXLPSA-N |
| XLogP | 2.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |