C21H25NO — CID 98695596
2-[(2R,4R,4aR,8aR)-4-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl]phenol (PubChem CID 98695596) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[(2R,4R,4aR,8aR)-4-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl]phenol.
| Compound Name | 2-[(2R,4R,4aR,8aR)-4-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl]phenol |
|---|---|
| PubChem CID | 98695596 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-[(2R,4R,4aR,8aR)-4-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl]phenol |
| SMILES | Oc1ccccc1[C@H]1C[C@@H](c2ccccc2)[C@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C21H25NO/c23-21-13-7-5-11-17(21)20-14-18(15-8-2-1-3-9-15)16-10-4-6-12-19(16)22-20/h1-3,5,7-9,11,13,16,18-20,22-23H,4,6,10,12,14H2/t16-,18+,19-,20-/m1/s1 |
| InChIKey | FAXYOLVJOUGVAO-GSEOLPGOSA-N |
| XLogP | 4.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|