C18H17NO4 — CID 124890677
5-[(2R)-2-[(E)-2-phenylethenyl]pyrrolidine-1-carbonyl]furan-2-carboxylic acid (PubChem CID 124890677) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 5-[(2R)-2-[(E)-2-phenylethenyl]pyrrolidine-1-carbonyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2R)-2-[(E)-2-phenylethenyl]pyrrolidine-1-carbonyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 124890677 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 5-[(2R)-2-[(E)-2-phenylethenyl]pyrrolidine-1-carbonyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCC[C@@H]2/C=C/c2ccccc2)o1 |
| InChI | InChI=1S/C18H17NO4/c20-17(15-10-11-16(23-15)18(21)22)19-12-4-7-14(19)9-8-13-5-2-1-3-6-13/h1-3,5-6,8-11,14H,4,7,12H2,(H,21,22)/b9-8+/t14-/m1/s1 |
| InChIKey | YLPCBVIOBMRWIX-MYSGNRETSA-N |
| XLogP | 3.30 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |