C22H24N2O3S — CID 91944122
N-cyclopropyl-3-[2-(2-phenylethenyl)pyrrolidine-1-carbonyl]benzenesulfonamide (PubChem CID 91944122) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-cyclopropyl-3-[2-(2-phenylethenyl)pyrrolidine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-3-[2-(2-phenylethenyl)pyrrolidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91944122 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-cyclopropyl-3-[2-(2-phenylethenyl)pyrrolidine-1-carbonyl]benzenesulfonamide |
| SMILES | O=C(c1cccc(S(=O)(=O)NC2CC2)c1)N1CCCC1C=Cc1ccccc1 |
| InChI | InChI=1S/C22H24N2O3S/c25-22(18-8-4-10-21(16-18)28(26,27)23-19-12-13-19)24-15-5-9-20(24)14-11-17-6-2-1-3-7-17/h1-4,6-8,10-11,14,16,19-20,23H,5,9,12-13,15H2 |
| InChIKey | RPAUXOVQYPSDMY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |