C14H16F3NO2S — CID 11723464
2-[(E)-2-phenylethenyl]-1-(trifluoromethylsulfonyl)piperidine (PubChem CID 11723464) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-1-(trifluoromethylsulfonyl)piperidine.
| Compound Name | 2-[(E)-2-phenylethenyl]-1-(trifluoromethylsulfonyl)piperidine |
|---|---|
| PubChem CID | 11723464 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-1-(trifluoromethylsulfonyl)piperidine |
| SMILES | O=S(=O)(N1CCCCC1/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2S/c15-14(16,17)21(19,20)18-11-5-4-8-13(18)10-9-12-6-2-1-3-7-12/h1-3,6-7,9-10,13H,4-5,8,11H2/b10-9+ |
| InChIKey | XISFFTSPWMNREH-MDZDMXLPSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |