C14H12NO4- — CID 18389962
(1R,2R,3R,4S)-3-(phenylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18389962) has the molecular formula C14H12NO4- and a molecular weight of 258.25 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-(phenylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2R,3R,4S)-3-(phenylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18389962 |
| Molecular Formula | C14H12NO4- |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (1R,2R,3R,4S)-3-(phenylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Nc1ccccc1)[C@@H]1[C@@H](C(=O)[O-])[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C14H13NO4/c16-13(15-8-4-2-1-3-5-8)11-9-6-7-10(19-9)12(11)14(17)18/h1-7,9-12H,(H,15,16)(H,17,18)/p-1/t9-,10+,11-,12-/m0/s1 |
| InChIKey | JUSVTXVHDCYHIJ-USZNOCQGSA-M |
| XLogP | -0.06 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|