C14H13N2O6S- — CID 11903133
(1S,2R,3R,4R)-3-[(4-sulfamoylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11903133) has the molecular formula C14H13N2O6S- and a molecular weight of 337.33 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-[(4-sulfamoylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2R,3R,4R)-3-[(4-sulfamoylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11903133 |
| Molecular Formula | C14H13N2O6S- |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (1S,2R,3R,4R)-3-[(4-sulfamoylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)[C@@H]2[C@@H](C(=O)[O-])[C@@H]3C=C[C@H]2O3)cc1 |
| InChI | InChI=1S/C14H14N2O6S/c15-23(20,21)8-3-1-7(2-4-8)16-13(17)11-9-5-6-10(22-9)12(11)14(18)19/h1-6,9-12H,(H,16,17)(H,18,19)(H2,15,20,21)/p-1/t9-,10+,11+,12+/m1/s1 |
| InChIKey | BEPJNJTXJUEIDK-RHYQMDGZSA-M |
| XLogP | -1.41 |
| TPSA | 138.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|