C20H16NO5- — CID 18390539
(1R,2R,3S,4S)-3-[(4-phenoxyphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18390539) has the molecular formula C20H16NO5- and a molecular weight of 350.35 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-[(4-phenoxyphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2R,3S,4S)-3-[(4-phenoxyphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18390539 |
| Molecular Formula | C20H16NO5- |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (1R,2R,3S,4S)-3-[(4-phenoxyphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H](C(=O)Nc2ccc(Oc3ccccc3)cc2)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C20H17NO5/c22-19(17-15-10-11-16(26-15)18(17)20(23)24)21-12-6-8-14(9-7-12)25-13-4-2-1-3-5-13/h1-11,15-18H,(H,21,22)(H,23,24)/p-1/t15-,16+,17+,18-/m0/s1 |
| InChIKey | ZGFLPXBNBVLCET-MLHJIOFPSA-M |
| XLogP | 1.74 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|