C14H10Cl2NO4- — CID 11879385
(1S,2R,3S,4R)-3-[(3,5-dichlorophenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11879385) has the molecular formula C14H10Cl2NO4- and a molecular weight of 327.14 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-[(3,5-dichlorophenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2R,3S,4R)-3-[(3,5-dichlorophenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11879385 |
| Molecular Formula | C14H10Cl2NO4- |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | (1S,2R,3S,4R)-3-[(3,5-dichlorophenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H](C(=O)Nc2cc(Cl)cc(Cl)c2)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C14H11Cl2NO4/c15-6-3-7(16)5-8(4-6)17-13(18)11-9-1-2-10(21-9)12(11)14(19)20/h1-5,9-12H,(H,17,18)(H,19,20)/p-1/t9-,10+,11-,12+/m1/s1 |
| InChIKey | LPMJXZCKUWKSPX-KXNHARMFSA-M |
| XLogP | 1.25 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|