C15H10ClF3NO4- — CID 18555080
(1R,2R,3R,4S)-3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18555080) has the molecular formula C15H10ClF3NO4- and a molecular weight of 360.70 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2R,3R,4S)-3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18555080 |
| Molecular Formula | C15H10ClF3NO4- |
| Molecular Weight | 360.70 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | (1R,2R,3R,4S)-3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)[C@@H]1[C@@H](C(=O)[O-])[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C15H11ClF3NO4/c16-7-2-1-6(15(17,18)19)5-8(7)20-13(21)11-9-3-4-10(24-9)12(11)14(22)23/h1-5,9-12H,(H,20,21)(H,22,23)/p-1/t9-,10+,11-,12-/m0/s1 |
| InChIKey | CDXZRWCETYMXEM-USZNOCQGSA-M |
| XLogP | 1.62 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.70 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|