C19H18ClF3N2O — CID 17152284
N-[2-chloro-5-(trifluoromethyl)phenyl]-1-phenylpiperidine-4-carboxamide (PubChem CID 17152284) has the molecular formula C19H18ClF3N2O and a molecular weight of 382.81 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-1-phenylpiperidine-4-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-1-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 17152284 |
| Molecular Formula | C19H18ClF3N2O |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-1-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)C1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H18ClF3N2O/c20-16-7-6-14(19(21,22)23)12-17(16)24-18(26)13-8-10-25(11-9-13)15-4-2-1-3-5-15/h1-7,12-13H,8-11H2,(H,24,26) |
| InChIKey | KSFKBJFJPBHPPC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |