C24H22ClF3N2O — CID 43924053
N-[2-chloro-5-(trifluoromethyl)phenyl]-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide (PubChem CID 43924053) has the molecular formula C24H22ClF3N2O and a molecular weight of 446.90 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43924053 |
| Molecular Formula | C24H22ClF3N2O |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)C1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C24H22ClF3N2O/c25-21-9-8-19(24(26,27)28)14-22(21)29-23(31)17-10-12-30(13-11-17)15-18-6-3-5-16-4-1-2-7-20(16)18/h1-9,14,17H,10-13,15H2,(H,29,31) |
| InChIKey | QYNKVWMTALDIDI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |