C20H21Cl3N2O — CID 45007317
1-[(2-methylphenyl)methyl]-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide (PubChem CID 45007317) has the molecular formula C20H21Cl3N2O and a molecular weight of 411.76 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-methylphenyl)methyl]-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45007317 |
| Molecular Formula | C20H21Cl3N2O |
| Molecular Weight | 411.76 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccccc1CN1CCC(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H21Cl3N2O/c1-13-4-2-3-5-15(13)12-25-8-6-14(7-9-25)20(26)24-19-11-17(22)16(21)10-18(19)23/h2-5,10-11,14H,6-9,12H2,1H3,(H,24,26) |
| InChIKey | CWMQEIXMPGVWNS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.76 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|