C18H17Cl3N2O — CID 17152279
1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide (PubChem CID 17152279) has the molecular formula C18H17Cl3N2O and a molecular weight of 383.71 g/mol. Its IUPAC name is 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17152279 |
| Molecular Formula | C18H17Cl3N2O |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H17Cl3N2O/c19-14-10-16(21)17(11-15(14)20)22-18(24)12-6-8-23(9-7-12)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2,(H,22,24) |
| InChIKey | FZJXATOCPZQXFM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|