About 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide
1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide (PubChem CID 17152279) has the molecular formula C18H17Cl3N2O
and a molecular weight of 383.71 g/mol. Its IUPAC name is 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
| PubChem CID | 17152279 |
| Molecular Formula | C18H17Cl3N2O |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H17Cl3N2O/c19-14-10-16(21)17(11-15(14)20)22-18(24)12-6-8-23(9-7-12)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2,(H,22,24) |
| InChIKey | FZJXATOCPZQXFM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide?
The IUPAC name of 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide (CID 17152279) is 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide.
What is the SMILES notation for 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide?
The canonical SMILES for 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide is O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1CCN(c2ccccc2)CC1.
What is the InChIKey of 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide?
The InChIKey is FZJXATOCPZQXFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl3N2O/c19-14-10-16(21)17(11-15(14)20)22-18(24)12-6-8-23(9-7-12)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2,(H,22,24).
What are the key properties of 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide?
1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide has a molecular weight of 383.71 g/mol, XLogP of 5.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide is sourced from PubChem (CID 17152279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).