C23H23IN2O — CID 43920099
N-(4-iodophenyl)-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide (PubChem CID 43920099) has the molecular formula C23H23IN2O and a molecular weight of 470.35 g/mol. Its IUPAC name is N-(4-iodophenyl)-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide.
| Compound Name | N-(4-iodophenyl)-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43920099 |
| Molecular Formula | C23H23IN2O |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | N-(4-iodophenyl)-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)C1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C23H23IN2O/c24-20-8-10-21(11-9-20)25-23(27)18-12-14-26(15-13-18)16-19-6-3-5-17-4-1-2-7-22(17)19/h1-11,18H,12-16H2,(H,25,27) |
| InChIKey | DVRLLERTRGMSMU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|