C28H33N3O2 — CID 43923580
N-[2-(butan-2-ylcarbamoyl)phenyl]-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide (PubChem CID 43923580) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[2-(butan-2-ylcarbamoyl)phenyl]-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(butan-2-ylcarbamoyl)phenyl]-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43923580 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | N-[2-(butan-2-ylcarbamoyl)phenyl]-1-(naphthalen-1-ylmethyl)piperidine-4-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)C1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C28H33N3O2/c1-3-20(2)29-28(33)25-13-6-7-14-26(25)30-27(32)22-15-17-31(18-16-22)19-23-11-8-10-21-9-4-5-12-24(21)23/h4-14,20,22H,3,15-19H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | ALSLEFWTGHHKMA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |