C24H26ClF3N2O2 — CID 126059758
1-(4-tert-butylbenzoyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 126059758) has the molecular formula C24H26ClF3N2O2 and a molecular weight of 466.93 g/mol. Its IUPAC name is 1-(4-tert-butylbenzoyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-tert-butylbenzoyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126059758 |
| Molecular Formula | C24H26ClF3N2O2 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-(4-tert-butylbenzoyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC(C(=O)Nc3cc(C(F)(F)F)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C24H26ClF3N2O2/c1-23(2,3)17-6-4-16(5-7-17)22(32)30-12-10-15(11-13-30)21(31)29-20-14-18(24(26,27)28)8-9-19(20)25/h4-9,14-15H,10-13H2,1-3H3,(H,29,31) |
| InChIKey | OWJDWEQXHIJORV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |