C25H32N2O2 — CID 113006485
1-(4-tert-butylbenzoyl)-N-(3,5-dimethylphenyl)piperidine-4-carboxamide (PubChem CID 113006485) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-(4-tert-butylbenzoyl)-N-(3,5-dimethylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-tert-butylbenzoyl)-N-(3,5-dimethylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113006485 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-(4-tert-butylbenzoyl)-N-(3,5-dimethylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C2CCN(C(=O)c3ccc(C(C)(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C25H32N2O2/c1-17-14-18(2)16-22(15-17)26-23(28)19-10-12-27(13-11-19)24(29)20-6-8-21(9-7-20)25(3,4)5/h6-9,14-16,19H,10-13H2,1-5H3,(H,26,28) |
| InChIKey | RGCKNEAGKHVBNE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |