C12H12ClF3N2O2 — CID 43120795
N-[2-chloro-5-(trifluoromethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 43120795) has the molecular formula C12H12ClF3N2O2 and a molecular weight of 308.69 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43120795 |
| Molecular Formula | C12H12ClF3N2O2 |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)C1CC(O)CN1 |
| InChI | InChI=1S/C12H12ClF3N2O2/c13-8-2-1-6(12(14,15)16)3-9(8)18-11(20)10-4-7(19)5-17-10/h1-3,7,10,17,19H,4-5H2,(H,18,20) |
| InChIKey | GWNUITMVDQKBBL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |