C13H12F3N3O2 — CID 43703870
N-[4-cyano-2-(trifluoromethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 43703870) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is N-[4-cyano-2-(trifluoromethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-[4-cyano-2-(trifluoromethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43703870 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[4-cyano-2-(trifluoromethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2CC(O)CN2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3N3O2/c14-13(15,16)9-3-7(5-17)1-2-10(9)19-12(21)11-4-8(20)6-18-11/h1-3,8,11,18,20H,4,6H2,(H,19,21) |
| InChIKey | QFHQNJALZDJMDN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |