C13H18N2O2 — CID 43120806
N-(2,5-dimethylphenyl)-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 43120806) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43120806 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2CC(O)CN2)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-8-3-4-9(2)11(5-8)15-13(17)12-6-10(16)7-14-12/h3-5,10,12,14,16H,6-7H2,1-2H3,(H,15,17) |
| InChIKey | ONKDXGRJDOFAFX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |