C12H16N2O4 — CID 102695323
4-hydroxy-N-(2-hydroxy-4-methoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 102695323) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-hydroxy-N-(2-hydroxy-4-methoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-(2-hydroxy-4-methoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102695323 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-hydroxy-N-(2-hydroxy-4-methoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(O)CN2)c(O)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-18-8-2-3-9(11(16)5-8)14-12(17)10-4-7(15)6-13-10/h2-3,5,7,10,13,15-16H,4,6H2,1H3,(H,14,17) |
| InChIKey | GWEOATXJKZKTES-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|