C13H15FN2O4 — CID 43703157
methyl 4-fluoro-3-[(4-hydroxypyrrolidine-2-carbonyl)amino]benzoate (PubChem CID 43703157) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is methyl 4-fluoro-3-[(4-hydroxypyrrolidine-2-carbonyl)amino]benzoate.
| Compound Name | methyl 4-fluoro-3-[(4-hydroxypyrrolidine-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 43703157 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 4-fluoro-3-[(4-hydroxypyrrolidine-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(F)c(NC(=O)C2CC(O)CN2)c1 |
| InChI | InChI=1S/C13H15FN2O4/c1-20-13(19)7-2-3-9(14)10(4-7)16-12(18)11-5-8(17)6-15-11/h2-4,8,11,15,17H,5-6H2,1H3,(H,16,18) |
| InChIKey | LEYDMMXEDCYEIX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |