C16H7Cl7F3NO3 — CID 98527752
(1S,2R,3R,4S)-1,4,5,6,7,7-hexachloro-3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98527752) has the molecular formula C16H7Cl7F3NO3 and a molecular weight of 566.40 g/mol. Its IUPAC name is (1S,2R,3R,4S)-1,4,5,6,7,7-hexachloro-3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4S)-1,4,5,6,7,7-hexachloro-3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98527752 |
| Molecular Formula | C16H7Cl7F3NO3 |
| Molecular Weight | 566.40 g/mol |
| Exact Mass | 562.82 |
| IUPAC Name | (1S,2R,3R,4S)-1,4,5,6,7,7-hexachloro-3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H](C(=O)Nc2cc(C(F)(F)F)ccc2Cl)[C@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C16H7Cl7F3NO3/c17-5-2-1-4(15(24,25)26)3-6(5)27-11(28)7-8(12(29)30)14(21)10(19)9(18)13(7,20)16(14,22)23/h1-3,7-8H,(H,27,28)(H,29,30)/t7-,8-,13+,14+/m1/s1 |
| InChIKey | QRSAKDDGTUBSLW-WTVOAAGRSA-N |
| XLogP | 6.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.40 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|