C15H8Cl7NO3 — CID 98545500
(1S,2S,3S,4S)-1,4,5,6,7,7-hexachloro-3-[(4-chlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98545500) has the molecular formula C15H8Cl7NO3 and a molecular weight of 498.40 g/mol. Its IUPAC name is (1S,2S,3S,4S)-1,4,5,6,7,7-hexachloro-3-[(4-chlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3S,4S)-1,4,5,6,7,7-hexachloro-3-[(4-chlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98545500 |
| Molecular Formula | C15H8Cl7NO3 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 494.83 |
| IUPAC Name | (1S,2S,3S,4S)-1,4,5,6,7,7-hexachloro-3-[(4-chlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](C(=O)Nc2ccc(Cl)cc2)[C@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C15H8Cl7NO3/c16-5-1-3-6(4-2-5)23-11(24)7-8(12(25)26)14(20)10(18)9(17)13(7,19)15(14,21)22/h1-4,7-8H,(H,23,24)(H,25,26)/t7-,8-,13-,14-/m0/s1 |
| InChIKey | AUEIDCNWVWJAST-MQXWNXJFSA-N |
| XLogP | 5.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|