C18H25NO2 — CID 101399997
tert-butyl 2-methyl-7-phenyl-2,3,6,7-tetrahydroazepine-1-carboxylate (PubChem CID 101399997) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl 2-methyl-7-phenyl-2,3,6,7-tetrahydroazepine-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-7-phenyl-2,3,6,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 101399997 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | tert-butyl 2-methyl-7-phenyl-2,3,6,7-tetrahydroazepine-1-carboxylate |
| SMILES | CC1CC=CCC(c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO2/c1-14-10-8-9-13-16(15-11-6-5-7-12-15)19(14)17(20)21-18(2,3)4/h5-9,11-12,14,16H,10,13H2,1-4H3 |
| InChIKey | FNIOFFRCTQSZHR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|