C17H24NO6P — CID 72962244
tert-butyl 2-dimethoxyphosphoryl-3-oxo-5-phenylpyrrolidine-1-carboxylate (PubChem CID 72962244) has the molecular formula C17H24NO6P and a molecular weight of 369.35 g/mol. Its IUPAC name is tert-butyl 2-dimethoxyphosphoryl-3-oxo-5-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-dimethoxyphosphoryl-3-oxo-5-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 72962244 |
| Molecular Formula | C17H24NO6P |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | tert-butyl 2-dimethoxyphosphoryl-3-oxo-5-phenylpyrrolidine-1-carboxylate |
| SMILES | COP(=O)(OC)C1C(=O)CC(c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24NO6P/c1-17(2,3)24-16(20)18-13(12-9-7-6-8-10-12)11-14(19)15(18)25(21,22-4)23-5/h6-10,13,15H,11H2,1-5H3 |
| InChIKey | GQOGMATZIVQEJD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|