C15H28NO5P — CID 53473107
tert-butyl (2R,3aS,7aS)-2-dimethoxyphosphoryl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 53473107) has the molecular formula C15H28NO5P and a molecular weight of 333.37 g/mol. Its IUPAC name is tert-butyl (2R,3aS,7aS)-2-dimethoxyphosphoryl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | tert-butyl (2R,3aS,7aS)-2-dimethoxyphosphoryl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 53473107 |
| Molecular Formula | C15H28NO5P |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | tert-butyl (2R,3aS,7aS)-2-dimethoxyphosphoryl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | COP(=O)(OC)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28NO5P/c1-15(2,3)21-14(17)16-12-9-7-6-8-11(12)10-13(16)22(18,19-4)20-5/h11-13H,6-10H2,1-5H3/t11-,12-,13+/m0/s1 |
| InChIKey | RPFVNCXKGIZQHV-RWMBFGLXSA-N |
| XLogP | 4.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|