C15H28NO6P — CID 72766947
tert-butyl 5-tert-butyl-2-dimethoxyphosphoryl-3-oxopyrrolidine-1-carboxylate (PubChem CID 72766947) has the molecular formula C15H28NO6P and a molecular weight of 349.36 g/mol. Its IUPAC name is tert-butyl 5-tert-butyl-2-dimethoxyphosphoryl-3-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-tert-butyl-2-dimethoxyphosphoryl-3-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 72766947 |
| Molecular Formula | C15H28NO6P |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | tert-butyl 5-tert-butyl-2-dimethoxyphosphoryl-3-oxopyrrolidine-1-carboxylate |
| SMILES | COP(=O)(OC)C1C(=O)CC(C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28NO6P/c1-14(2,3)11-9-10(17)12(23(19,20-7)21-8)16(11)13(18)22-15(4,5)6/h11-12H,9H2,1-8H3 |
| InChIKey | PWWLORXDMGQNCB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|