C16H28NO7P — CID 11552577
1-O-tert-butyl 2-O-methyl (2S,4S,5R)-5-dimethoxyphosphoryl-4-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 11552577) has the molecular formula C16H28NO7P and a molecular weight of 377.37 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S,5R)-5-dimethoxyphosphoryl-4-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S,5R)-5-dimethoxyphosphoryl-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11552577 |
| Molecular Formula | C16H28NO7P |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S,5R)-5-dimethoxyphosphoryl-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@H]1C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)[C@@H]1P(=O)(OC)OC |
| InChI | InChI=1S/C16H28NO7P/c1-8-9-11-10-12(14(18)21-5)17(15(19)24-16(2,3)4)13(11)25(20,22-6)23-7/h8,11-13H,1,9-10H2,2-7H3/t11-,12-,13+/m0/s1 |
| InChIKey | HDSPHWMFOZNKMY-RWMBFGLXSA-N |
| XLogP | 3.17 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|