C21H24N2O3 — CID 101128966
(2S,4S)-2-(2-hydroxy-3-methylbut-3-en-2-yl)-N,4-diphenyl-1,3-oxazolidine-3-carboxamide (PubChem CID 101128966) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2S,4S)-2-(2-hydroxy-3-methylbut-3-en-2-yl)-N,4-diphenyl-1,3-oxazolidine-3-carboxamide.
| Compound Name | (2S,4S)-2-(2-hydroxy-3-methylbut-3-en-2-yl)-N,4-diphenyl-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 101128966 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (2S,4S)-2-(2-hydroxy-3-methylbut-3-en-2-yl)-N,4-diphenyl-1,3-oxazolidine-3-carboxamide |
| SMILES | C=C(C)C(C)(O)[C@@H]1OC[C@H](c2ccccc2)N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H24N2O3/c1-15(2)21(3,25)19-23(20(24)22-17-12-8-5-9-13-17)18(14-26-19)16-10-6-4-7-11-16/h4-13,18-19,25H,1,14H2,2-3H3,(H,22,24)/t18-,19+,21?/m1/s1 |
| InChIKey | BEHWQFDIEQSEFL-QSJYAPKHSA-N |
| XLogP | 3.95 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|