C15H22NO6P — CID 164604037
2-diethoxyphosphoryl-1-[(4R)-2-hydroxy-4-phenyl-1,3-oxazolidin-3-yl]ethanone (PubChem CID 164604037) has the molecular formula C15H22NO6P and a molecular weight of 343.32 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1-[(4R)-2-hydroxy-4-phenyl-1,3-oxazolidin-3-yl]ethanone.
| Compound Name | 2-diethoxyphosphoryl-1-[(4R)-2-hydroxy-4-phenyl-1,3-oxazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 164604037 |
| Molecular Formula | C15H22NO6P |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-diethoxyphosphoryl-1-[(4R)-2-hydroxy-4-phenyl-1,3-oxazolidin-3-yl]ethanone |
| SMILES | CCOP(=O)(CC(=O)N1C(O)OC[C@H]1c1ccccc1)OCC |
| InChI | InChI=1S/C15H22NO6P/c1-3-21-23(19,22-4-2)11-14(17)16-13(10-20-15(16)18)12-8-6-5-7-9-12/h5-9,13,15,18H,3-4,10-11H2,1-2H3/t13-,15?/m0/s1 |
| InChIKey | CPPNGQIPCOXDBF-CFMCSPIPSA-N |
| XLogP | 2.13 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|