C25H33N2O5P — CID 139728196
(4S,5S)-4-butyl-1-(2-diethoxyphosphorylacetyl)-4,5-diphenylimidazolidin-2-one (PubChem CID 139728196) has the molecular formula C25H33N2O5P and a molecular weight of 472.52 g/mol. Its IUPAC name is (4S,5S)-4-butyl-1-(2-diethoxyphosphorylacetyl)-4,5-diphenylimidazolidin-2-one.
| Compound Name | (4S,5S)-4-butyl-1-(2-diethoxyphosphorylacetyl)-4,5-diphenylimidazolidin-2-one |
|---|---|
| PubChem CID | 139728196 |
| Molecular Formula | C25H33N2O5P |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (4S,5S)-4-butyl-1-(2-diethoxyphosphorylacetyl)-4,5-diphenylimidazolidin-2-one |
| SMILES | CCCC[C@@]1(c2ccccc2)NC(=O)N(C(=O)CP(=O)(OCC)OCC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H33N2O5P/c1-4-7-18-25(21-16-12-9-13-17-21)23(20-14-10-8-11-15-20)27(24(29)26-25)22(28)19-33(30,31-5-2)32-6-3/h8-17,23H,4-7,18-19H2,1-3H3,(H,26,29)/t23-,25-/m0/s1 |
| InChIKey | FBDGURSEBWRTLR-ZCYQVOJMSA-N |
| XLogP | 5.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|