C29H43NO3Sn — CID 11330588
benzyl (2R,4R)-4-phenyl-2-tributylstannyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11330588) has the molecular formula C29H43NO3Sn and a molecular weight of 572.38 g/mol. Its IUPAC name is benzyl (2R,4R)-4-phenyl-2-tributylstannyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (2R,4R)-4-phenyl-2-tributylstannyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11330588 |
| Molecular Formula | C29H43NO3Sn |
| Molecular Weight | 572.38 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | benzyl (2R,4R)-4-phenyl-2-tributylstannyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H]1OC[C@@H](c2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H16NO3.3C4H9.Sn/c19-17(21-11-14-7-3-1-4-8-14)18-13-20-12-16(18)15-9-5-2-6-10-15;3*1-3-4-2;/h1-10,13,16H,11-12H2;3*1,3-4H2,2H3;/t16-;;;;/m0..../s1 |
| InChIKey | PFHNAIAEYXYTLT-FXAGWRDUSA-N |
| XLogP | 8.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.38 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |