C24H33NO2Si — CID 101207425
tert-butyl (2R,3R,4R)-3,4-diphenyl-2-trimethylsilylpyrrolidine-1-carboxylate (PubChem CID 101207425) has the molecular formula C24H33NO2Si and a molecular weight of 395.62 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R)-3,4-diphenyl-2-trimethylsilylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,4R)-3,4-diphenyl-2-trimethylsilylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101207425 |
| Molecular Formula | C24H33NO2Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | tert-butyl (2R,3R,4R)-3,4-diphenyl-2-trimethylsilylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2ccccc2)[C@H](c2ccccc2)[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C24H33NO2Si/c1-24(2,3)27-23(26)25-17-20(18-13-9-7-10-14-18)21(22(25)28(4,5)6)19-15-11-8-12-16-19/h7-16,20-22H,17H2,1-6H3/t20-,21-,22+/m0/s1 |
| InChIKey | HMOKIBHKLAZVHO-FDFHNCONSA-N |
| XLogP | 6.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|