C18H21NO4 — CID 10519409
tert-butyl (2S)-2-[(1S,2S,5R,6S)-4-oxo-6-phenyl-3-oxabicyclo[3.1.0]hexan-2-yl]aziridine-1-carboxylate (PubChem CID 10519409) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1S,2S,5R,6S)-4-oxo-6-phenyl-3-oxabicyclo[3.1.0]hexan-2-yl]aziridine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1S,2S,5R,6S)-4-oxo-6-phenyl-3-oxabicyclo[3.1.0]hexan-2-yl]aziridine-1-carboxylate |
|---|---|
| PubChem CID | 10519409 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | tert-butyl (2S)-2-[(1S,2S,5R,6S)-4-oxo-6-phenyl-3-oxabicyclo[3.1.0]hexan-2-yl]aziridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]1[C@H]1OC(=O)[C@@H]2[C@@H](c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C18H21NO4/c1-18(2,3)23-17(21)19-9-11(19)15-13-12(14(13)16(20)22-15)10-7-5-4-6-8-10/h4-8,11-15H,9H2,1-3H3/t11-,12-,13-,14+,15+,19?/m0/s1 |
| InChIKey | BGZWRMKPSKQEHG-QLCYVVNQSA-N |
| XLogP | 2.56 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|