C11H17N3O4S — CID 175926830
tert-butyl [[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methylamino] carbonate (PubChem CID 175926830) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is tert-butyl [[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methylamino] carbonate.
| Compound Name | tert-butyl [[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methylamino] carbonate |
|---|---|
| PubChem CID | 175926830 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | tert-butyl [[4-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methylamino] carbonate |
| SMILES | CC(C)(C)OC(=O)ONCc1cc(C(N)=NO)cs1 |
| InChI | InChI=1S/C11H17N3O4S/c1-11(2,3)17-10(15)18-13-5-8-4-7(6-19-8)9(12)14-16/h4,6,13,16H,5H2,1-3H3,(H2,12,14) |
| InChIKey | ZGPHSYAQQIITHX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|