C17H27N3O6S2 — CID 172855404
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[[4-(N'-methylsulfonylcarbamimidoyl)thiophen-2-yl]methyl]carbamate (PubChem CID 172855404) has the molecular formula C17H27N3O6S2 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[[4-(N'-methylsulfonylcarbamimidoyl)thiophen-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[[4-(N'-methylsulfonylcarbamimidoyl)thiophen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 172855404 |
| Molecular Formula | C17H27N3O6S2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[[4-(N'-methylsulfonylcarbamimidoyl)thiophen-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cc(C(N)=NS(C)(=O)=O)cs1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O6S2/c1-16(2,3)25-14(21)20(15(22)26-17(4,5)6)9-12-8-11(10-27-12)13(18)19-28(7,23)24/h8,10H,9H2,1-7H3,(H2,18,19) |
| InChIKey | YQDGDTXINPFKGB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|