C19H29N3O5 — CID 177190571
tert-butyl N-[[4-[(Z)-N'-hydroxycarbamimidoyl]-2-methylphenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 177190571) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl N-[[4-[(Z)-N'-hydroxycarbamimidoyl]-2-methylphenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(Z)-N'-hydroxycarbamimidoyl]-2-methylphenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 177190571 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | tert-butyl N-[[4-[(Z)-N'-hydroxycarbamimidoyl]-2-methylphenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | Cc1cc(/C(N)=N/O)ccc1CN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29N3O5/c1-12-10-13(15(20)21-25)8-9-14(12)11-22(16(23)26-18(2,3)4)17(24)27-19(5,6)7/h8-10,25H,11H2,1-7H3,(H2,20,21) |
| InChIKey | XWRFFHNQYGOUIA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|