C15H22N2O3 — CID 86623613
tert-butyl 3-[4-(N'-hydroxycarbamimidoyl)-2-methylphenyl]propanoate (PubChem CID 86623613) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is tert-butyl 3-[4-(N'-hydroxycarbamimidoyl)-2-methylphenyl]propanoate.
| Compound Name | tert-butyl 3-[4-(N'-hydroxycarbamimidoyl)-2-methylphenyl]propanoate |
|---|---|
| PubChem CID | 86623613 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | tert-butyl 3-[4-(N'-hydroxycarbamimidoyl)-2-methylphenyl]propanoate |
| SMILES | Cc1cc(C(N)=NO)ccc1CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N2O3/c1-10-9-12(14(16)17-19)6-5-11(10)7-8-13(18)20-15(2,3)4/h5-6,9,19H,7-8H2,1-4H3,(H2,16,17) |
| InChIKey | ZJDPKJZZYJFAIA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|