C16H25N3O5S — CID 172798732
tert-butyl N-[[5-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 172798732) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is tert-butyl N-[[5-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[[5-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 172798732 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | tert-butyl N-[[5-(N'-hydroxycarbamimidoyl)thiophen-2-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(C(N)=NO)s1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N3O5S/c1-15(2,3)23-13(20)19(14(21)24-16(4,5)6)9-10-7-8-11(25-10)12(17)18-22/h7-8,22H,9H2,1-6H3,(H2,17,18) |
| InChIKey | QOESITKRUQUNCL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|