C11H16N2OS — CID 114484067
4-(ethylsulfanylmethyl)-N'-hydroxy-3-methylbenzenecarboximidamide (PubChem CID 114484067) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 4-(ethylsulfanylmethyl)-N'-hydroxy-3-methylbenzenecarboximidamide.
| Compound Name | 4-(ethylsulfanylmethyl)-N'-hydroxy-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114484067 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-(ethylsulfanylmethyl)-N'-hydroxy-3-methylbenzenecarboximidamide |
| SMILES | CCSCc1ccc(/C(N)=N/O)cc1C |
| InChI | InChI=1S/C11H16N2OS/c1-3-15-7-10-5-4-9(6-8(10)2)11(12)13-14/h4-6,14H,3,7H2,1-2H3,(H2,12,13) |
| InChIKey | IVSMGQPZZOZFHV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|