C9H11N5O — CID 154501666
4-(azidomethyl)-N'-hydroxy-3-methylbenzenecarboximidamide (PubChem CID 154501666) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-(azidomethyl)-N'-hydroxy-3-methylbenzenecarboximidamide.
| Compound Name | 4-(azidomethyl)-N'-hydroxy-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 154501666 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-(azidomethyl)-N'-hydroxy-3-methylbenzenecarboximidamide |
| SMILES | Cc1cc(C(N)=NO)ccc1CN=[N+]=[N-] |
| InChI | InChI=1S/C9H11N5O/c1-6-4-7(9(10)13-15)2-3-8(6)5-12-14-11/h2-4,15H,5H2,1H3,(H2,10,13) |
| InChIKey | AACAHELKNHZWRS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|