C7H11N3O2S2 — CID 172800896
5-(aminomethyl)-N'-methylsulfonylthiophene-3-carboximidamide (PubChem CID 172800896) has the molecular formula C7H11N3O2S2 and a molecular weight of 233.32 g/mol. Its IUPAC name is 5-(aminomethyl)-N'-methylsulfonylthiophene-3-carboximidamide.
| Compound Name | 5-(aminomethyl)-N'-methylsulfonylthiophene-3-carboximidamide |
|---|---|
| PubChem CID | 172800896 |
| Molecular Formula | C7H11N3O2S2 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 5-(aminomethyl)-N'-methylsulfonylthiophene-3-carboximidamide |
| SMILES | CS(=O)(=O)N=C(N)c1csc(CN)c1 |
| InChI | InChI=1S/C7H11N3O2S2/c1-14(11,12)10-7(9)5-2-6(3-8)13-4-5/h2,4H,3,8H2,1H3,(H2,9,10) |
| InChIKey | QVRCYAHDWDUAII-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|