C12H18ClN3O2S — CID 172760046
tert-butyl 2-[5-(aminomethyl)thiophene-3-carboximidoyl]iminoacetate;hydrochloride (PubChem CID 172760046) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.81 g/mol. Its IUPAC name is tert-butyl 2-[5-(aminomethyl)thiophene-3-carboximidoyl]iminoacetate;hydrochloride.
| Compound Name | tert-butyl 2-[5-(aminomethyl)thiophene-3-carboximidoyl]iminoacetate;hydrochloride |
|---|---|
| PubChem CID | 172760046 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | tert-butyl 2-[5-(aminomethyl)thiophene-3-carboximidoyl]iminoacetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N=C\C(=O)OC(C)(C)C)c1csc(CN)c1 |
| InChI | InChI=1S/C12H17N3O2S.ClH/c1-12(2,3)17-10(16)6-15-11(14)8-4-9(5-13)18-7-8;/h4,6-7,14H,5,13H2,1-3H3;1H/b14-11-,15-6+; |
| InChIKey | LODVNEFDOIGBDD-SCANCTCISA-N |
| XLogP | 2.37 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|