C6H11Cl2N3S — CID 22716030
5-(aminomethyl)thiophene-3-carboximidamide;dihydrochloride (PubChem CID 22716030) has the molecular formula C6H11Cl2N3S and a molecular weight of 228.15 g/mol. Its IUPAC name is 5-(aminomethyl)thiophene-3-carboximidamide;dihydrochloride.
| Compound Name | 5-(aminomethyl)thiophene-3-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 22716030 |
| Molecular Formula | C6H11Cl2N3S |
| Molecular Weight | 228.15 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 5-(aminomethyl)thiophene-3-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1csc(CN)c1 |
| InChI | InChI=1S/C6H9N3S.2ClH/c7-2-5-1-4(3-10-5)6(8)9;;/h1,3H,2,7H2,(H3,8,9);2*1H |
| InChIKey | GRWJYBPRAOPQPX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.15 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|